4-(1,3-thiazol-2-ylcarbamoylamino)benzoic acid structure
|
Common Name | 4-(1,3-thiazol-2-ylcarbamoylamino)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 69123-59-7 | Molecular Weight | 263.27200 | |
| Density | 1.594g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H9N3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(1,3-thiazol-2-ylcarbamoylamino)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.594g/cm3 |
|---|---|
| Molecular Formula | C11H9N3O3S |
| Molecular Weight | 263.27200 |
| Exact Mass | 263.03600 |
| PSA | 119.56000 |
| LogP | 2.63130 |
| Index of Refraction | 1.768 |
| InChIKey | JBGKVDKEIBEZMT-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccc(C(=O)O)cc1)Nc1nccs1 |
|
~%
4-(1,3-thiazol-... CAS#:69123-59-7 |
| Literature: Zee-Cheng,K.Y.; Cheng,C.C. Journal of Medicinal Chemistry, 1979 , vol. 22, p. 28 - 32 |
|
~%
4-(1,3-thiazol-... CAS#:69123-59-7 |
| Literature: Zee-Cheng,K.Y.; Cheng,C.C. Journal of Medicinal Chemistry, 1979 , vol. 22, p. 28 - 32 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-(3-thiazol-2-yl-ureido)-benzoic acid |
| Benzoic acid,4-[[(2-thiazolylamino)carbonyl]amino] |