N-(4-butan-2-ylphenyl)-3-oxobutanamide structure
|
Common Name | N-(4-butan-2-ylphenyl)-3-oxobutanamide | ||
|---|---|---|---|---|
| CAS Number | 690991-18-5 | Molecular Weight | 233.30600 | |
| Density | 1.064g/cm3 | Boiling Point | 400.8ºC at 760 mmHg | |
| Molecular Formula | C14H19NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 152.1ºC | |
| Name | N-(4-butan-2-ylphenyl)-3-oxobutanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.064g/cm3 |
|---|---|
| Boiling Point | 400.8ºC at 760 mmHg |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.30600 |
| Flash Point | 152.1ºC |
| Exact Mass | 233.14200 |
| PSA | 46.17000 |
| LogP | 3.19070 |
| Index of Refraction | 1.538 |
| InChIKey | MENBMIDWRMRXHX-UHFFFAOYSA-N |
| SMILES | CCC(C)c1ccc(NC(=O)CC(C)=O)cc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-(4-sec-butylphenyl)-3-oxobutanamide |
| HMS2415N12 |