CHEMBRDG-BB 5355794
Modify Date: 2024-01-02 21:48:23
CHEMBRDG-BB 5355794 structure
|
Common Name | CHEMBRDG-BB 5355794 | ||
|---|---|---|---|---|
| CAS Number | 20331-29-7 | Molecular Weight | 239.74100 | |
| Density | 1.104g/cm3 | Boiling Point | 389.8ºC at 760 mmHg | |
| Molecular Formula | C13H18ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 189.6ºC | |
| Name | N-(4-butan-2-ylphenyl)-3-chloropropanamide |
|---|
| Density | 1.104g/cm3 |
|---|---|
| Boiling Point | 389.8ºC at 760 mmHg |
| Molecular Formula | C13H18ClNO |
| Molecular Weight | 239.74100 |
| Flash Point | 189.6ºC |
| Exact Mass | 239.10800 |
| PSA | 29.10000 |
| LogP | 3.84050 |
| Vapour Pressure | 2.77E-06mmHg at 25°C |
| Index of Refraction | 1.547 |
| InChIKey | LNERRDGMCUENRC-UHFFFAOYSA-N |
| SMILES | CCC(C)c1ccc(NC(=O)CCCl)cc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |