Tris(trimethylsiloxy)ethylene structure
|
Common Name | Tris(trimethylsiloxy)ethylene | ||
|---|---|---|---|---|
| CAS Number | 69097-20-7 | Molecular Weight | 292.595 | |
| Density | 0.9±0.1 g/cm3 | Boiling Point | 272.9±0.0 °C at 760 mmHg | |
| Molecular Formula | C11H28O3Si3 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 95.2±22.2 °C | |
| Symbol |
GHS02, GHS07 |
Signal Word | Warning | |
| Name | Tris(trimethylsilyloxy)ethylene |
|---|---|
| Synonym | More Synonyms |
| Density | 0.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 272.9±0.0 °C at 760 mmHg |
| Molecular Formula | C11H28O3Si3 |
| Molecular Weight | 292.595 |
| Flash Point | 95.2±22.2 °C |
| Exact Mass | 292.134613 |
| PSA | 27.69000 |
| LogP | 5.55 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.425 |
| InChIKey | FCZGHPGTZRTDNN-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)OC=C(O[Si](C)(C)C)O[Si](C)(C)C |
| Storage condition | 2-8°C |
| Symbol |
GHS02, GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H226-H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R10;R36/37/38 |
| Safety Phrases | S26-S36-S37/39-S16 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| Packaging Group | III |
| Hazard Class | 3.2 |
|
~88%
Tris(trimethyls... CAS#:69097-20-7 |
| Literature: Oesterle, Thomas; Simchen, Gerhard Liebigs Annalen der Chemie, 1987 , p. 687 - 692 |
|
~%
Tris(trimethyls... CAS#:69097-20-7 |
| Literature: Journal of Organic Chemistry, , vol. 44, # 25 p. 4617 - 4622 |
| Precursor 3 | |
|---|---|
| DownStream 6 | |
|
Stereospecific total synthesis of ajugarin-IV. Kende AS, et al.
Tetrahedron Lett. 23(17) , 1751-54, (1982)
|
|
|
Multienzymatic preparation of 3-[(1R)-1-hydroxyethyl] benzoic acid and (2< i> S</i>)-hydroxy (phenyl) ethanoic acid. Gennaro PD, et al.
Tetrahedron Asymmetry 21(15) , 1885-89, (2010)
|
| Tris(trimethylsiloxy)ethylene |
| 3,6-Dioxa-2,7-disilaoct-4-ene, 2,2,7,7-tetramethyl-4-[(trimethylsilyl)oxy]- |
| 2,2,7,7-Tetramethyl-4-[(trimethylsilyl)oxy]-3,6-dioxa-2,7-disilaoct-4-ene |
| 1,2-bis(trimethylsilyloxy)ethenoxy-trimethylsilane |
| EINECS 273-864-1 |
| Silane, [1-ethenyl-2-ylidenetris(oxy)]tris[trimethyl- |
| MFCD00011641 |