Dansyl-Glu-Gly-Arg-chloromethylketone
Modify Date: 2025-09-24 17:33:35
Dansyl-Glu-Gly-Arg-chloromethylketone structure
|
Common Name | Dansyl-Glu-Gly-Arg-chloromethylketone | ||
|---|---|---|---|---|
| CAS Number | 69024-84-6 | Molecular Weight | 626.12 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H36ClN7O7S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Dansyl-Glu-Gly-Arg-chloromethylketoneDansyl-Glu-Gly-Arg-Chloromethylketone is a protease inhibitor, and inhibits serine/threonine proteases. Dansyl-Glu-Gly-Arg-Chloromethylketone inhibits activated porcine factor IX[1]. |
| Name | (4S)-5-[[2-[[(3S)-1-chloro-6-(diaminomethylideneamino)-2-oxohexan-3-yl]amino]-2-oxoethyl]amino]-4-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]-5-oxopentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Dansyl-Glu-Gly-Arg-Chloromethylketone is a protease inhibitor, and inhibits serine/threonine proteases. Dansyl-Glu-Gly-Arg-Chloromethylketone inhibits activated porcine factor IX[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C26H36ClN7O7S |
|---|---|
| Molecular Weight | 626.12 |
| Exact Mass | 625.20900 |
| PSA | 232.26000 |
| LogP | 3.53410 |
| InChIKey | LDMSFLLWFAFZAF-OALUTQOASA-N |
| SMILES | CN(C)c1cccc2c(S(=O)(=O)NC(CCC(=O)O)C(=O)NCC(=O)NC(CCCN=C(N)N)C(=O)CCl)cccc12 |
| EGRck |
| Degr-CK |
| Dansyl-ggack |
| Dggacmk |
| Dansyl-Glu-Gly-Arg-Chloromethylketone |
| glycinamide,n-[[5-(dimethylamino)-1-naphthalenyl]sulfonyl]-l-|A-glutamyl-n-[(1s)-1-(2-chloroacetyl)-4-[(diaminomethylene)amino]butyl] |