valerophenone tosylhydrazone mixture o&
Modify Date: 2025-08-25 00:08:21
valerophenone tosylhydrazone mixture o& structure
|
Common Name | valerophenone tosylhydrazone mixture o& | ||
|---|---|---|---|---|
| CAS Number | 69015-74-3 | Molecular Weight | 330.44400 | |
| Density | 1.12g/cm3 | Boiling Point | 471.3ºC at 760 mmHg | |
| Molecular Formula | C18H22N2O2S | Melting Point | 132-136ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Name | 4-methyl-N-(1-phenylpentylideneamino)benzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.12g/cm3 |
|---|---|
| Boiling Point | 471.3ºC at 760 mmHg |
| Melting Point | 132-136ºC(lit.) |
| Molecular Formula | C18H22N2O2S |
| Molecular Weight | 330.44400 |
| Exact Mass | 330.14000 |
| PSA | 66.91000 |
| LogP | 5.33950 |
| Index of Refraction | 1.567 |
| InChIKey | VTEOESQGMPJHGP-UHFFFAOYSA-N |
| SMILES | CCCCC(=NNS(=O)(=O)c1ccc(C)cc1)c1ccccc1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Safety Phrases | 22-24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2935009090 |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| MFCD00159338 |
| valerophenone tosylhydrazone |