Deoxyribonucleic acid sodium salt structure
|
Common Name | Deoxyribonucleic acid sodium salt | ||
|---|---|---|---|---|
| CAS Number | 68938-01-2 | Molecular Weight | 380.208 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 596.9±50.0 °C at 760 mmHg | |
| Molecular Formula | C17H15BrFNO3 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 314.8±30.1 °C | |
| Name | 3-Bromo-N-[(4-fluorophenyl)acetyl]phenylalanine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 596.9±50.0 °C at 760 mmHg |
| Molecular Formula | C17H15BrFNO3 |
| Molecular Weight | 380.208 |
| Flash Point | 314.8±30.1 °C |
| Exact Mass | 379.021942 |
| LogP | 3.19 |
| Appearance of Characters | buffered aqueous solution | Off-white |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Index of Refraction | 1.602 |
| InChIKey | GXZCYECDYOBPGH-UHFFFAOYSA-N |
| SMILES | O=C(Cc1ccc(F)cc1)NC(Cc1cccc(Br)c1)C(=O)O |
| Storage condition | 2-8°C |
| Water Solubility | 50 mM Tris pH 8.0: 10 mg/mL, clear, faintly brown-yellow |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | B |
| Safety Phrases | S22;S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| RTECS | HG1933000 |
|
Apoptosis and gene expression in the developing mouse brain of fusarenon-X-treated pregnant mice.
Toxicol. Lett. 229(1) , 292-302, (2014) Fusarenon-X (FX), a type B trichothecene mycotoxin, is mainly produced by Fusarium crookwellense, which occurs naturally in agricultural commodities, such as wheat and barley. FX has been shown to exe... |
|
|
Unnatural base pairs: (n., pl.) man-made carbon-based molecules that can substitute for or extend the natural set of molecules that make up DNA.
Sci. Am. 311(2) , 21, (2014)
|
|
|
A lucid build-up of nanostructured curcumin, quercetin and their interaction with DNA.
J. Nanosci. Nanotechnol. 14(7) , 4874-9, (2014) Nanostructured phyto-drugs such as curcumin and quercetin were prepared by simple sonochemical method and studied for their bio-activities. FT-IR spectra indicate that the chemical structures of these... |
| MFCD00130922 |
| Phenylalanine, 3-bromo-N-[2-(4-fluorophenyl)acetyl]- |
| EINECS 309-566-6 |
| 3-Bromo-N-[(4-fluorophenyl)acetyl]phenylalanine |
| Deoxyribonucleic acids salmon sperm |