N-(2,6-dimethylphenyl)furan-2-carboxamide
Modify Date: 2025-08-25 19:47:30
N-(2,6-dimethylphenyl)furan-2-carboxamide structure
|
Common Name | N-(2,6-dimethylphenyl)furan-2-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 68873-22-3 | Molecular Weight | 215.24800 | |
| Density | 1.172g/cm3 | Boiling Point | 246.8ºC at 760 mmHg | |
| Molecular Formula | C13H13NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 103.1ºC | |
| Name | N-(2,6-dimethylphenyl)furan-2-carboxamide |
|---|
| Density | 1.172g/cm3 |
|---|---|
| Boiling Point | 246.8ºC at 760 mmHg |
| Molecular Formula | C13H13NO2 |
| Molecular Weight | 215.24800 |
| Flash Point | 103.1ºC |
| Exact Mass | 215.09500 |
| PSA | 42.24000 |
| LogP | 3.22170 |
| Index of Refraction | 1.599 |
| InChIKey | JHKXLXFJRVUZRH-UHFFFAOYSA-N |
| SMILES | Cc1cccc(C)c1NC(=O)c1ccco1 |
| HS Code | 2932190090 |
|---|
|
~%
N-(2,6-dimethyl... CAS#:68873-22-3 |
| Literature: Buu-Hoi; Nguyen-Hoan Recueil des Travaux Chimiques des Pays-Bas, 1949 , vol. 68, p. 5,19 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |