2-(Benzyloxy)-1-bromo-3-nitrobenzene
Modify Date: 2025-10-22 13:28:22
2-(Benzyloxy)-1-bromo-3-nitrobenzene structure
|
Common Name | 2-(Benzyloxy)-1-bromo-3-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 688363-79-3 | Molecular Weight | 308.12700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H10BrNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-bromo-3-nitro-2-phenylmethoxybenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H10BrNO3 |
|---|---|
| Molecular Weight | 308.12700 |
| Exact Mass | 306.98400 |
| PSA | 55.05000 |
| LogP | 4.45950 |
| InChIKey | IJAMXMAVDDCHHD-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc(Br)c1OCc1ccccc1 |
| HS Code | 2909309090 |
|---|
|
~10%
2-(Benzyloxy)-1... CAS#:688363-79-3 |
| Literature: BAYER INTELLECTUAL PROPERTY GMBH; SÜßMEIER, Frank; LOBELL, Mario; GRÜNEWALD, Sylvia; HÄRTER, Michael; BUCHMANN, Bernd; TELSER, Joachim; JÖRIßEN, Hannah; HEROULT, Melanie; KAHNERT, Antje; LUSTIG, Klemens; LINDNER, Niels Patent: US2013/190290 A1, 2013 ; Location in patent: Paragraph 1053; 1054; 1055; 1056 ; |
|
~92%
2-(Benzyloxy)-1... CAS#:688363-79-3 |
| Literature: Cho, Sung Yun; Lee, Byung Ho; Jung, Heejung; Yun, Chang Soo; Ha, Jae Du; Kim, Hyoung Rae; Chae, Chong Hak; Lee, Jeong Hyun; Seo, Ho Won; Oh, Kwang-Seok Bioorganic and Medicinal Chemistry Letters, 2013 , vol. 23, # 24 p. 6711 - 6716 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1-bromo-3-nitro-2-[(phenylmethyl)oxy]benzene |
| BEN338 |
| 2-(benzyloxy)-1-bromo-3-nitrobenzene |