Echitamine chloride
Modify Date: 2025-08-26 14:11:51
Echitamine chloride structure
|
Common Name | Echitamine chloride | ||
|---|---|---|---|---|
| CAS Number | 6878-36-0 | Molecular Weight | 385.47700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H29ClN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Echitamine chlorideEchitamine chloride is the major monoterpene indole alkaloid present in Alstonia with potent anti-tumour activity. Echitamine chloride induces DNA fragmentation and cells apoptosis. Echitamine chloride inhibits pancreatic lipase with an IC50 of 10.92 µM[1][2]. |
| Name | echetamine chloride |
|---|
| Description | Echitamine chloride is the major monoterpene indole alkaloid present in Alstonia with potent anti-tumour activity. Echitamine chloride induces DNA fragmentation and cells apoptosis. Echitamine chloride inhibits pancreatic lipase with an IC50 of 10.92 µM[1][2]. |
|---|---|
| Related Catalog | |
| Target |
IC50: 10.92 µM (Pancreatic lipase)[2] |
| References |
| Molecular Formula | C22H29ClN2O4 |
|---|---|
| Molecular Weight | 385.47700 |
| Exact Mass | 385.21300 |
| PSA | 78.79000 |
| LogP | 1.48570 |
| InChIKey | QYXFKPCRGWUWAM-CPPNUAKTSA-M |
| SMILES | CC=C1C[N+]2(C)CCC34c5ccccc5NC32C(O)CC1C4(CO)C(=O)OC.[Cl-] |