Isowighteone
Modify Date: 2025-08-25 11:53:15
Isowighteone structure
|
Common Name | Isowighteone | ||
|---|---|---|---|---|
| CAS Number | 68436-47-5 | Molecular Weight | 338.354 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 579.0±50.0 °C at 760 mmHg | |
| Molecular Formula | C20H18O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210.0±23.6 °C | |
Use of IsowighteoneIsowigtheone is a cytotoxic isoflavone compound isolated from the root barks of Brosimum utile. Isowigtheone has the potential for the research of cancer diseases[1]. |
| Name | 5,7-Dihydroxy-3-[4-hydroxy-3-(3-methyl-2-buten-1-yl)phenyl]-4H-ch romen-4-one |
|---|---|
| Synonym | More Synonyms |
| Description | Isowigtheone is a cytotoxic isoflavone compound isolated from the root barks of Brosimum utile. Isowigtheone has the potential for the research of cancer diseases[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 579.0±50.0 °C at 760 mmHg |
| Molecular Formula | C20H18O5 |
| Molecular Weight | 338.354 |
| Flash Point | 210.0±23.6 °C |
| Exact Mass | 338.115417 |
| PSA | 90.90000 |
| LogP | 5.05 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.667 |
| InChIKey | SWDSVBNAMCDHTF-UHFFFAOYSA-N |
| SMILES | CC(C)=CCc1cc(-c2coc3cc(O)cc(O)c3c2=O)ccc1O |
| Hazard Codes | Xi |
|---|
| 5,7-Dihydroxy-3-[4-hydroxy-3-(3-methyl-but-2-enyl)-phenyl]-chromen-4-one |
| 5,7-Dihydroxy-3-[4-hydroxy-3-(3-methyl-2-buten-1-yl)phenyl]-4H-chromen-4-one |
| isovitexin 4'-O-glucoside |
| isosaponarin |
| Isoviolastyren |
| isowighteone |
| Isoviolastyrol |
| 4H-1-Benzopyran-4-one, 5,7-dihydroxy-3-[4-hydroxy-3-(3-methyl-2-buten-1-yl)phenyl]- |
| Isovitexin-4'-O-glucosid |
| Isovitexin-4'-glucoside |
| 3'-isoprenylgenistein |