Polysulfides, di-tert-dodecyl
Modify Date: 2025-08-25 06:25:50
Polysulfides, di-tert-dodecyl structure
|
Common Name | Polysulfides, di-tert-dodecyl | ||
|---|---|---|---|---|
| CAS Number | 68425-15-0 | Molecular Weight | 434.84900 | |
| Density | 1.01 g/mL at 25ºC | Boiling Point | 470.6ºC at 760 mmHg | |
| Molecular Formula | C24H50S3 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | >230 °F | |
| Name | 2-(2,3,3,4,5,5-hexamethylhexan-2-yltrisulfanyl)-2,3,3,4,5,5-hexamethylhexane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.01 g/mL at 25ºC |
|---|---|
| Boiling Point | 470.6ºC at 760 mmHg |
| Molecular Formula | C24H50S3 |
| Molecular Weight | 434.84900 |
| Flash Point | >230 °F |
| Exact Mass | 434.30700 |
| PSA | 75.90000 |
| LogP | 9.99000 |
| Index of Refraction | n20/D 1.545 |
| InChIKey | AWSNFBCZTJENAR-UHFFFAOYSA-N |
| SMILES | CC(C(C)(C)C)C(C)(C)C(C)(C)SSSC(C)(C)C(C)(C)C(C)C(C)(C)C |
| Hazard Statements | H413 |
|---|---|
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Phrases | R36/38 |
| Safety Phrases | S26;S36/S37/S39 |
| RIDADR | NONH for all modes of transport |
| Polysulfides,di-tert-dodecyl |
| tert-Dodecanethiol,sulfurized |
| EINECS 270-335-7 |
| MFCD00804305 |