1-phenylselanylpyrrolidine-2,5-dione structure
|
Common Name | 1-phenylselanylpyrrolidine-2,5-dione | ||
|---|---|---|---|---|
| CAS Number | 68395-72-2 | Molecular Weight | 254.14400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H9NO2Se | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-phenylselanylpyrrolidine-2,5-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H9NO2Se |
|---|---|
| Molecular Weight | 254.14400 |
| Exact Mass | 254.98000 |
| PSA | 37.38000 |
| LogP | 0.01800 |
| InChIKey | WPQVHQFZUKWNMD-UHFFFAOYSA-N |
| SMILES | O=C1CCC(=O)N1[Se]c1ccccc1 |
|
~84%
1-phenylselanyl... CAS#:68395-72-2 |
| Literature: Scianowski, Jacek; WeLniak, MirosLaw Phosphorus, Sulfur and Silicon and the Related Elements, 2009 , vol. 184, # 6 p. 1440 - 1447 |
|
~%
1-phenylselanyl... CAS#:68395-72-2 |
| Literature: Hosay; Christiaens; Anthoine; Moniotte Tetrahedron Letters, 1990 , vol. 31, # 6 p. 873 - 874 |
| phenylselenenylsuccinimide |
| N-phenylselenosuccinimide |
| N-phenylselenophthalimide |