ethyl 3-(3-iodophenyl)-3-oxopropanoate
Modify Date: 2025-08-25 20:29:39
ethyl 3-(3-iodophenyl)-3-oxopropanoate structure
|
Common Name | ethyl 3-(3-iodophenyl)-3-oxopropanoate | ||
|---|---|---|---|---|
| CAS Number | 68332-33-2 | Molecular Weight | 318.10800 | |
| Density | 1.604 g/mL at 25ºC(lit.) | Boiling Point | 353.2ºC at 760 mmHg | |
| Molecular Formula | C11H11IO3 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | >230 °F | |
| Name | ethyl 3-(3-iodophenyl)-3-oxopropanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.604 g/mL at 25ºC(lit.) |
|---|---|
| Boiling Point | 353.2ºC at 760 mmHg |
| Molecular Formula | C11H11IO3 |
| Molecular Weight | 318.10800 |
| Flash Point | >230 °F |
| Exact Mass | 317.97500 |
| PSA | 43.37000 |
| LogP | 2.42710 |
| Index of Refraction | n20/D 1.5960(lit.) |
| InChIKey | BJAFBVNGJCARIJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)c1cccc(I)c1 |
| Personal Protective Equipment | Eyeshields;Gloves |
|---|---|
| RIDADR | NONH for all modes of transport |
| HS Code | 2918300090 |
|
~97%
ethyl 3-(3-iodo... CAS#:68332-33-2 |
| Literature: Xin, Zhili; Liu, Gang; Pei, Zhonghua; Szczepankiewicz, Bruce G.; Serby, Michael D.; Zhao, Hongyu Patent: US2004/214870 A1, 2004 ; Location in patent: Page 27 ; US 20040214870 A1 |
|
~97%
ethyl 3-(3-iodo... CAS#:68332-33-2 |
| Literature: Xin, Zhili; Liu, Gang; Pei, Zhonghua; Szczepankiewicz, Bruce G.; Serby, Michael D.; Zhao, Hongyu Patent: US2004/167188 A1, 2004 ; US 20040167188 A1 |
|
~%
ethyl 3-(3-iodo... CAS#:68332-33-2 |
| Literature: Journal of Organic Chemistry, , vol. 44, # 2 p. 310 - 311 |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| MFCD03424814 |