(5-BROMO-1-BENZOFURAN-2-YL)METHANOL
Modify Date: 2025-08-26 12:04:46
(5-BROMO-1-BENZOFURAN-2-YL)METHANOL structure
|
Common Name | (5-BROMO-1-BENZOFURAN-2-YL)METHANOL | ||
|---|---|---|---|---|
| CAS Number | 68287-72-9 | Molecular Weight | 343.17500 | |
| Density | 1.5g/cm3 | Boiling Point | 469ºC at 760 mmHg | |
| Molecular Formula | C16H11BrN2O2 | Melting Point | 143-148ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 237.4ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | (5-bromo-2-hydroxyphenyl)-(1-phenylpyrazol-4-yl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5g/cm3 |
|---|---|
| Boiling Point | 469ºC at 760 mmHg |
| Melting Point | 143-148ºC(lit.) |
| Molecular Formula | C16H11BrN2O2 |
| Molecular Weight | 343.17500 |
| Flash Point | 237.4ºC |
| Exact Mass | 342.00000 |
| PSA | 55.12000 |
| LogP | 3.57140 |
| Index of Refraction | 1.67 |
| InChIKey | MPZOVJOEZZCBKJ-UHFFFAOYSA-N |
| SMILES | O=C(c1cnn(-c2ccccc2)c1)c1cc(Br)ccc1O |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| RIDADR | NONH for all modes of transport |
|
~72%
(5-BROMO-1-BENZ... CAS#:68287-72-9 |
| Literature: Sabitha, Gowravaram; Satheesh Babu; Yadav Synthetic Communications, 1998 , vol. 28, # 24 p. 4571 - 4576 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
|
Anti-inflammatory and anti-tumor activity of the marine mangrove Rhizophora apiculata.
J. Immunotoxicol. 9(4) , 341-52, (2012) A methanolic extract of Rhizophora apiculata was evaluated for its anti-inflammatory and anti-tumor activity against B16F10 melanoma cells in BALB/c mice. The administration of R. apiculata extract wa... |
| MFCD02093263 |
| (5-Bromo-2-hydroxy-phenyl)-(1-phenyl-1H-pyrazol-4-yl)ketone |
| (5-bromo-2-hydroxy-phenyl)-(1-phenyl-1H-pyrazol-4-yl)-methanone |
| 5-bromo-2-hydroxyphenyl 1-phenylpyrazol-4-yl ketone |