Phenyl 2-aminobenzenesulfonate structure
|
Common Name | Phenyl 2-aminobenzenesulfonate | ||
|---|---|---|---|---|
| CAS Number | 68227-69-0 | Molecular Weight | 249.286 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 435.0±37.0 °C at 760 mmHg | |
| Molecular Formula | C12H11NO3S | Melting Point | 70-73 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 216.9±26.5 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | Phenyl-2-aminobenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 435.0±37.0 °C at 760 mmHg |
| Melting Point | 70-73 °C(lit.) |
| Molecular Formula | C12H11NO3S |
| Molecular Weight | 249.286 |
| Flash Point | 216.9±26.5 °C |
| Exact Mass | 249.045959 |
| PSA | 77.77000 |
| LogP | 2.68 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.626 |
| InChIKey | DELFPZLNAZAZRE-UHFFFAOYSA-N |
| SMILES | Nc1ccccc1S(=O)(=O)Oc1ccccc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
|
~%
Phenyl 2-aminob... CAS#:68227-69-0 |
| Literature: US2134642 , ; DE709584 , ; DRP/DRBP Org.Chem. |
|
~%
Phenyl 2-aminob... CAS#:68227-69-0 |
| Literature: Journal of Organic Chemistry, , vol. 50, # 18 p. 3336 - 3341 |
|
~%
Phenyl 2-aminob... CAS#:68227-69-0 |
| Literature: Journal of Organic Chemistry, , vol. 50, # 18 p. 3336 - 3341 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
|
A convenient route to diverse heterocycles through an addition of beta-amino carbonyl compounds to 3-halogeno-4-methoxybenzynes.
J. Org. Chem. 70(14) , 5741-4, (2005) [reaction: see text] 3-Halogeno-4-methoxybenzynes 5 generated from 5-(3-halogeno-4-methoxyphenyl)thianthrenium perchlorates 1 and LDA in THF at reflux reacted with various beta-amino carbonyl compound... |
| MFCD03093960 |
| Benzenesulfonic acid, 2-amino-, phenyl ester |
| o-Aminobenzene sulfonic acid phenyl ester; 2- Aminobenzene sulfonic acid phenyl ester |
| EINECS 269-381-0 |
| Phenyl 2-aminobenzenesulfonate |