2,6-Bis(trifluoromethyl)benzeneboronic acid
Modify Date: 2025-08-25 09:40:20
2,6-Bis(trifluoromethyl)benzeneboronic acid structure
|
Common Name | 2,6-Bis(trifluoromethyl)benzeneboronic acid | ||
|---|---|---|---|---|
| CAS Number | 681812-07-7 | Molecular Weight | 257.92600 | |
| Density | 1.5g/cm3 | Boiling Point | 258.3ºC at 760 mmHg | |
| Molecular Formula | C8H5BF6O2 | Melting Point | 168-171ºC | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2,6-Bis(trifluoromethyl)phenyl)boronic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5g/cm3 |
|---|---|
| Boiling Point | 258.3ºC at 760 mmHg |
| Melting Point | 168-171ºC |
| Molecular Formula | C8H5BF6O2 |
| Molecular Weight | 257.92600 |
| Exact Mass | 258.02900 |
| PSA | 40.46000 |
| LogP | 1.40400 |
| Index of Refraction | 1.419 |
| InChIKey | WAMPGNNEOZGBHR-UHFFFAOYSA-N |
| SMILES | OB(O)c1c(C(F)(F)F)cccc1C(F)(F)F |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2931900090 |
|
~%
2,6-Bis(trifluo... CAS#:681812-07-7 |
| Literature: Dalton Transactions, , # 23 p. 4395 - 4405 |
|
~%
2,6-Bis(trifluo... CAS#:681812-07-7 |
| Literature: Dalton Transactions, , # 23 p. 4395 - 4405 |
|
~%
2,6-Bis(trifluo... CAS#:681812-07-7 |
| Literature: Dalton Transactions, , # 23 p. 4395 - 4405 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| [2,6-bis(trifluoromethyl)phenyl]boronic acid |
| MFCD04039321 |