Disialo-Asn structure
|
Common Name | Disialo-Asn | ||
|---|---|---|---|---|
| CAS Number | 68141-38-8 | Molecular Weight | 2338.11 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 889.4±65.0 °C at 760 mmHg | |
| Molecular Formula | C88H144N8O64 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 491.7±34.3 °C | |
Use of Disialo-AsnDisialo-Asn is a N-Glycan and sialate glycopeptide. Disialo-Asn can be used for modify nucleic acids[1]. |
| Name | SGN |
|---|---|
| Synonym | More Synonyms |
| Description | Disialo-Asn is a N-Glycan and sialate glycopeptide. Disialo-Asn can be used for modify nucleic acids[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 889.4±65.0 °C at 760 mmHg |
| Molecular Formula | C88H144N8O64 |
| Molecular Weight | 2338.11 |
| Flash Point | 491.7±34.3 °C |
| Exact Mass | 276.106995 |
| LogP | -2.77 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.570 |
| InChIKey | BPMRXBZYPGYPJN-WHFBIAKZSA-N |
| SMILES | NC(=O)CC(NC(=O)CNC(=O)C(N)CO)C(=O)O |
| (2S)-2-{2-[(2S)-2-amino-3-hydroxypropanamido]acetamido}-3-carbamoylpropanoic acid |
| L-Serylglycyl-L-asparagine |
| Disialo-Asn|Neu5Acα(2-6)Galβ(1-4)GlcNAcβ(1-2)Manα(1-3)[Neu5Acα(2-6)Galβ(1-4)GlcNAcβ(1-2)Manα(1-6)]Manβ(1-4)GlcNAcβ(1-4)GlcNAc-β-Asn |
| L-Asparagine, L-serylglycyl- |