n-4-nitrobenzyl-n-propylamine hydrochloride structure
|
Common Name | n-4-nitrobenzyl-n-propylamine hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 68133-98-2 | Molecular Weight | 230.69100 | |
| Density | N/A | Boiling Point | 307.1ºC at 760mmHg | |
| Molecular Formula | C10H15ClN2O2 | Melting Point | 233-235 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 139.5ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-Nitro-N-(n-propyl)benzylamine hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 307.1ºC at 760mmHg |
|---|---|
| Melting Point | 233-235 °C(lit.) |
| Molecular Formula | C10H15ClN2O2 |
| Molecular Weight | 230.69100 |
| Flash Point | 139.5ºC |
| Exact Mass | 230.08200 |
| PSA | 57.85000 |
| LogP | 3.81050 |
| InChIKey | LWISLZIFEARHJI-UHFFFAOYSA-N |
| SMILES | CCCNCc1ccc([N+](=O)[O-])cc1.Cl |
| Storage condition | 2-8°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2921499090 |
| HS Code | 2921499090 |
|---|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Corbini G, et al.
Analyst 116(7) , 731-734, (1991)
|
| n-4-nitrobenzyl-n-propylamine hydrochloride |
| MFCD00012845 |
| EINECS 268-721-5 |