1-(4-TERT-BUTYLPHENYL)PIPERAZINE structure
|
Common Name | 1-(4-TERT-BUTYLPHENYL)PIPERAZINE | ||
|---|---|---|---|---|
| CAS Number | 68104-61-0 | Molecular Weight | 218.33800 | |
| Density | 0.972g/cm3 | Boiling Point | 346.4ºC at 760mmHg | |
| Molecular Formula | C14H22N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 140.7ºC | |
| Name | 1-(4-tert-butylphenyl)piperazine |
|---|---|
| Synonym | More Synonyms |
| Density | 0.972g/cm3 |
|---|---|
| Boiling Point | 346.4ºC at 760mmHg |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.33800 |
| Flash Point | 140.7ºC |
| Exact Mass | 218.17800 |
| PSA | 15.27000 |
| LogP | 2.78750 |
| Index of Refraction | 1.519 |
| InChIKey | ORDMNUOREWSOKN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(N2CCNCC2)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933599090 |
|
~48%
1-(4-TERT-BUTYL... CAS#:68104-61-0 |
| Literature: Korea Institute of Science and Technology Patent: US2011/319619 A1, 2011 ; Location in patent: Page/Page column 6 ; |
|
~%
1-(4-TERT-BUTYL... CAS#:68104-61-0 |
| Literature: Romeo, Giuseppe; Materia, Luisa; Manetti, Fabrizio; Cagnotto, Alfredo; Mennini, Tiziana; Nicoletti, Ferdinando; Botta, Maurizio; Russo, Filippo; Minneman, Kenneth P. Journal of Medicinal Chemistry, 2003 , vol. 46, # 14 p. 2877 - 2894 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-(4-t-butylphenyl)piperazine |
| [4-(tert-butyl)phenyl]piperazine |
| N-(4-tert-butylphenyl)-piperazine |
| EINECS 268-473-8 |
| 1-[4-(1,1-dimethylethyl)phenyl]piperazine |
| 1-(4-(tert-butyl)phenyl)piperazine |