2,4-Diaminophenetole sulfate structure
|
Common Name | 2,4-Diaminophenetole sulfate | ||
|---|---|---|---|---|
| CAS Number | 68015-98-5 | Molecular Weight | 250.27200 | |
| Density | N/A | Boiling Point | 315.7ºC at 760 mmHg | |
| Molecular Formula | C8H14N2O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,4-Diamino phenetole sulfate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 315.7ºC at 760 mmHg |
|---|---|
| Molecular Formula | C8H14N2O5S |
| Molecular Weight | 250.27200 |
| Exact Mass | 250.06200 |
| PSA | 155.25000 |
| LogP | 1.97620 |
| InChIKey | WRYXZLYZWDZVKS-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(N)cc1N.O=S(=O)(O)O |
| Hazard Codes | T+ |
|---|---|
| RIDADR | 2811.0 |
| HS Code | 2922299090 |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2,4-Diaminophenetole sulfate |
| EINECS 268-164-8 |
| MFCD08460115 |