SFK1
Modify Date: 2025-08-28 07:42:46
SFK1 structure
|
Common Name | SFK1 | ||
|---|---|---|---|---|
| CAS Number | 678997-25-6 | Molecular Weight | 409.00500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H37ClN2O2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS05 |
Signal Word | Danger | |
Use of SFK1SKF1 is a FK506 suppressor, causes a mitochondrially induced death in low salt, concomitant with the release of reactive oxygen species (ROS)[1]. |
| Name | cyclohexylmethyl 4-(N'-octylcarbamimidoyl)benzoate,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Description | SKF1 is a FK506 suppressor, causes a mitochondrially induced death in low salt, concomitant with the release of reactive oxygen species (ROS)[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C23H37ClN2O2 |
|---|---|
| Molecular Weight | 409.00500 |
| Exact Mass | 408.25400 |
| PSA | 64.68000 |
| LogP | 6.99180 |
| InChIKey | URYYYIJUCLTKBY-UHFFFAOYSA-N |
| SMILES | CCCCCCCCN=C(N)c1ccc(C(=O)OCC2CCCCC2)cc1.Cl |
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H318 |
| Precautionary Statements | P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| RIDADR | NONH for all modes of transport |
| SFK1 |
| Suppressor of FK-506 1 |
| IN1091 |
| Cyclohexylmethyl 4-[imino(octylamino)methyl]benzoate hydrochloride |