2,3,5-trimethyl-6-(3-methylbut-2-enyl)benzene-1,4-diol structure
|
Common Name | 2,3,5-trimethyl-6-(3-methylbut-2-enyl)benzene-1,4-diol | ||
|---|---|---|---|---|
| CAS Number | 67883-69-6 | Molecular Weight | 220.30700 | |
| Density | 1.044g/cm3 | Boiling Point | 366.8ºC at 760 mmHg | |
| Molecular Formula | C14H20O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 171.6ºC | |
| Name | 2,3,5-trimethyl-6-(3-methylbut-2-enyl)benzene-1,4-diol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.044g/cm3 |
|---|---|
| Boiling Point | 366.8ºC at 760 mmHg |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.30700 |
| Flash Point | 171.6ºC |
| Exact Mass | 220.14600 |
| PSA | 40.46000 |
| LogP | 3.53170 |
| Index of Refraction | 1.556 |
| InChIKey | VBELYGYSIZESQP-UHFFFAOYSA-N |
| SMILES | CC(C)=CCc1c(C)c(O)c(C)c(C)c1O |
|
~%
2,3,5-trimethyl... CAS#:67883-69-6 |
| Literature: Naruta, Yoshinori Journal of the American Chemical Society, 1980 , vol. 102, # 11 p. 3774 - 3783 |
|
~5%
2,3,5-trimethyl... CAS#:67883-69-6 |
| Literature: Bigi, Franca; Carloni, Silvia; Maggi, Raimondo; Muchetti, Chiara; Rastelli, Massimo; Sartori, Giovanni Synthesis, 1998 , # 3 p. 301 - 304 |
| Trimethyl-(3-methyl-but-2-enyl)hydrochinon |