Fenpropimorph structure
|
Common Name | Fenpropimorph | ||
|---|---|---|---|---|
| CAS Number | 67564-91-4 | Molecular Weight | 303.48 | |
| Density | 0.928 g/cm3 | Boiling Point | 392.7ºC at 760 mmHg | |
| Molecular Formula | C20H33NO | Melting Point | 25°C | |
| MSDS | Chinese USA | Flash Point | 115.6ºC | |
| Symbol |
GHS07, GHS08, GHS09 |
Signal Word | Warning | |
Use of FenpropimorphFenpropimorph is a fungicide that inhibits the sterol pathway. Fenpropimorph inhibits δ8-δ7-sterol isomerase in yeast at low concentrations, with δ14-sterol reductase being blocked at higher levels, preventing the biosynthesis of ergosterol. Fenpropimorph also inhibits sterol synthesis in certain plants and mammalian cells[1][2][3]. |
| Name | fenpropimorph |
|---|---|
| Synonym | More Synonyms |
| Description | Fenpropimorph is a fungicide that inhibits the sterol pathway. Fenpropimorph inhibits δ8-δ7-sterol isomerase in yeast at low concentrations, with δ14-sterol reductase being blocked at higher levels, preventing the biosynthesis of ergosterol. Fenpropimorph also inhibits sterol synthesis in certain plants and mammalian cells[1][2][3]. |
|---|---|
| Related Catalog | |
| References |
| Density | 0.928 g/cm3 |
|---|---|
| Boiling Point | 392.7ºC at 760 mmHg |
| Melting Point | 25°C |
| Molecular Formula | C20H33NO |
| Molecular Weight | 303.48 |
| Flash Point | 115.6ºC |
| Exact Mass | 303.25600 |
| PSA | 12.47000 |
| LogP | 4.20980 |
| Index of Refraction | 1.49 |
| InChIKey | RYAUSSKQMZRMAI-ALOPSCKCSA-N |
| SMILES | CC(Cc1ccc(C(C)(C)C)cc1)CN1CC(C)OC(C)C1 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07, GHS08, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H315-H361d-H411 |
| Precautionary Statements | P273-P281 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter;type N95 (US);type P1 (EN143) respirator filter |
| Hazard Codes | Xn: Harmful;N: Dangerous for the environment; |
| Risk Phrases | R22;R38;R51/53;R63 |
| Safety Phrases | 36/37-46-61 |
| RIDADR | UN 3082 |
| RTECS | QE1940000 |
|
~0%
Fenpropimorph CAS#:67564-91-4 |
| Literature: GALDERMA S.A. Patent: WO2007/12983 A2, 2007 ; Location in patent: Page/Page column 13-16 ; |
|
~%
Fenpropimorph CAS#:67564-91-4 |
| Literature: EP1935889 A1, ; Page/Page column 8-9 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| cis-4-<3-(4-tert-butylphenyl)-2-methylpropyl>-2,6-dimethylmorpholine |
| 4,10-dioxatricyclo[5.2.1.0<2,6>]decan-3,5-dione |
| Wln: T C555 A ao dvovtj |
| demethylcantharidin |
| (2R,6S)-rel-4-[3-[4-(1,1-dimethylethyl)phenyl]-2-methylpropyl]-2,6-dimethylmorpholine |
| rac-(2R,6S)-4-[(2Ξ)-3-(4-tert-butylphenyl)-2-methylpropyl]-2,6-dimethylmorpholine |
| 3,6-Endooxyphthalic anhydride,hexahydro |
| MFCD00144306 |
| rel-(2R,6S)-4-[3-[4-(1,1-dimethylethyl)phenyl]-2-methylpropyl]-2,6-dimethylmorpholine |
| hexahydro-4,7-epoxyisobenzofuran-1,3-dione |
| 7-oxabicyclo[2,2,1]heptane-2,3-dicarboxylic acid anhydride |
| cis-exo-hexahydro-4,7-epoxyisobenzofuran-1,3-dione |
| 4-[3-(4-tert-butyl-phenyl)-2-methyl-propyl]-2,6-dimethyl-morpholine |
| EINECS 266-719-9 |
| Fenpropimorph |
| Demehylcantharidin |
| cis-4-[(RS)-3-(4-tert-butylphenyl)-2-methylpropyl]-2,6-dimethylmorpholine |
| Hexahydro-3,6-epoxyphthalic anhydride |
| Nocantharidin |
| cis-4-[3-(p-tert-butylphenyl)-2-methylpropyl]-2,6-dimethylmorpholine |
| (exo)hexahydro-4,7-epoxyisobenzofuran-1,3-dione |