2,6-Salicyloxylidide
Modify Date: 2025-08-25 19:37:00
2,6-Salicyloxylidide structure
|
Common Name | 2,6-Salicyloxylidide | ||
|---|---|---|---|---|
| CAS Number | 67520-11-0 | Molecular Weight | 241.28500 | |
| Density | 1.21g/cm3 | Boiling Point | 316.6ºC at 760 mmHg | |
| Molecular Formula | C15H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 145.3ºC | |
| Name | 2-[2-[4-[2-[4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenyl]propan-2-yl]phenoxy]ethoxy]ethyl 2-methylprop-2-enoate |
|---|
| Density | 1.21g/cm3 |
|---|---|
| Boiling Point | 316.6ºC at 760 mmHg |
| Molecular Formula | C15H15NO2 |
| Molecular Weight | 241.28500 |
| Flash Point | 145.3ºC |
| Exact Mass | 241.11000 |
| PSA | 49.33000 |
| LogP | 3.33430 |
| Index of Refraction | 1.646 |
| InChIKey | OEVSZXUCOOWVOO-UHFFFAOYSA-N |
| SMILES | Cc1cccc(C)c1NC(=O)c1ccccc1O |
| HS Code | 2924299090 |
|---|
|
~39%
2,6-Salicyloxylidide CAS#:67520-11-0 |
| Literature: Triola, Gemma; Wetzel, Stefan; Ellinger, Bernhard; Koch, Marcus A.; Huebel, Katja; Rauh, Daniel; Waldmann, Herbert Bioorganic and Medicinal Chemistry, 2009 , vol. 17, # 3 p. 1079 - 1087 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |