2,6-dichloro-4-(trifluoromethyl)phenylacetic acid
Modify Date: 2025-09-09 18:30:02
2,6-dichloro-4-(trifluoromethyl)phenylacetic acid structure
|
Common Name | 2,6-dichloro-4-(trifluoromethyl)phenylacetic acid | ||
|---|---|---|---|---|
| CAS Number | 132992-36-0 | Molecular Weight | 273.03600 | |
| Density | 0.978 g/mL at 20 °C | Boiling Point | 94-96 °C5 mm Hg(lit.) | |
| Molecular Formula | C9H5Cl2F3O2 | Melting Point | -87 °C | |
| MSDS | N/A | Flash Point | 223 °F | |
| Name | 2-[2,6-dichloro-4-(trifluoromethyl)phenyl]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 0.978 g/mL at 20 °C |
|---|---|
| Boiling Point | 94-96 °C5 mm Hg(lit.) |
| Melting Point | -87 °C |
| Molecular Formula | C9H5Cl2F3O2 |
| Molecular Weight | 273.03600 |
| Flash Point | 223 °F |
| Exact Mass | 271.96200 |
| PSA | 37.30000 |
| LogP | 3.63930 |
| Vapour density | 6.57 (vs air) |
| Vapour Pressure | 0.000521mmHg at 25°C |
| Index of Refraction | n20/D 1.441(lit.) |
| InChIKey | IGIZNOWEWCGVKX-UHFFFAOYSA-N |
| SMILES | O=C(O)Cc1c(Cl)cc(C(F)(F)F)cc1Cl |
| Water Solubility | 100 mg/L (20 ºC) |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| MFCD00190118 |