pentachlorophenol-ul-14c
Modify Date: 2025-08-27 14:11:33
pentachlorophenol-ul-14c structure
|
Common Name | pentachlorophenol-ul-14c | ||
|---|---|---|---|---|
| CAS Number | 67471-28-7 | Molecular Weight | 278.29200 | |
| Density | 1.804g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C6HCl5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | pentachlorophenol-ul-14c |
|---|---|
| Synonym | More Synonyms |
| Density | 1.804g/cm3 |
|---|---|
| Molecular Formula | C6HCl5O |
| Molecular Weight | 278.29200 |
| Exact Mass | 275.86600 |
| PSA | 20.23000 |
| LogP | 4.65920 |
| Appearance of Characters | toluene solution |
| Index of Refraction | 1.631 |
| InChIKey | IZUPBVBPLAPZRR-ZQBYOMGUSA-N |
| SMILES | Oc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| Storage condition | 2-8°C |
| Hazard Codes | F,T |
|---|---|
| Risk Phrases | R11;R40;R63;R23/24/25;R36/37/38 |
| Safety Phrases | S16;S23;S45;S53;S36/S37/S39 |
| RIDADR | UN 2910 7 |
| WGK Germany | 3 |
| MFCD00055722 |