2H-Benzo[a]quinolizin-2-one,1,3,4,6,7,11b-hexahydro-9,10-dimethoxy-3-(2-methyl-2-propen-1-yl)-
Modify Date: 2025-09-11 17:09:08
![2H-Benzo[a]quinolizin-2-one,1,3,4,6,7,11b-hexahydro-9,10-dimethoxy-3-(2-methyl-2-propen-1-yl)- Structure](https://image.chemsrc.com/caspic/233/67455-70-3.png)
2H-Benzo[a]quinolizin-2-one,1,3,4,6,7,11b-hexahydro-9,10-dimethoxy-3-(2-methyl-2-propen-1-yl)- structure
|
Common Name | 2H-Benzo[a]quinolizin-2-one,1,3,4,6,7,11b-hexahydro-9,10-dimethoxy-3-(2-methyl-2-propen-1-yl)- | ||
|---|---|---|---|---|
| CAS Number | 67455-70-3 | Molecular Weight | 315.40700 | |
| Density | 1.14g/cm3 | Boiling Point | 447.6ºC at 760 mmHg | |
| Molecular Formula | C19H25NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 224.5ºC | |
| Name | 9,10-dimethoxy-3-(2-methylprop-2-enyl)-1,3,4,6,7,11b-hexahydrobenzo[a]quinolizin-2-one |
|---|
| Density | 1.14g/cm3 |
|---|---|
| Boiling Point | 447.6ºC at 760 mmHg |
| Molecular Formula | C19H25NO3 |
| Molecular Weight | 315.40700 |
| Flash Point | 224.5ºC |
| Exact Mass | 315.18300 |
| PSA | 38.77000 |
| LogP | 3.09610 |
| Index of Refraction | 1.564 |
| InChIKey | IWAYHUXQWULHQH-UHFFFAOYSA-N |
| SMILES | C=C(C)CC1CN2CCc3cc(OC)c(OC)cc3C2CC1=O |
|
~16%
2H-Benzo[a]quin... CAS#:67455-70-3 |
| Literature: Zheng, Pinguan; Lieberman, Brian P.; Choi, Seok Rye; Ploeessl, Karl; Kung, Hank F. Bioorganic and Medicinal Chemistry Letters, 2011 , vol. 21, # 11 p. 3435 - 3438 |
|
~%
2H-Benzo[a]quin... CAS#:67455-70-3 |
| Literature: Brossi et al. Helvetica Chimica Acta, 1958 , vol. 41, p. 119,129 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |