H-Leu-Trp-Met-Arg-OH
Modify Date: 2025-09-08 19:50:59
H-Leu-Trp-Met-Arg-OH structure
|
Common Name | H-Leu-Trp-Met-Arg-OH | ||
|---|---|---|---|---|
| CAS Number | 67368-23-4 | Molecular Weight | 604.76500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H44N8O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of H-Leu-Trp-Met-Arg-OHH-Leu-Trp-Met-Arg-OH is a tetrapeptide. H-Leu-Trp-Met-Arg-OH can be used as a substrate for aminopeptidase-mediated hydrolysis studies[1]. |
| Name | (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-4-methylpentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-4-methylsulfanylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | H-Leu-Trp-Met-Arg-OH is a tetrapeptide. H-Leu-Trp-Met-Arg-OH can be used as a substrate for aminopeptidase-mediated hydrolysis studies[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C28H44N8O5S |
|---|---|
| Molecular Weight | 604.76500 |
| Exact Mass | 604.31600 |
| PSA | 264.08000 |
| LogP | 5.05130 |
| InChIKey | QDSRMRPAGMXZLU-UDIDDNNKSA-N |
| SMILES | CSCCC(NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C(N)CC(C)C)C(=O)NC(CCCN=C(N)N)C(=O)O |
| L-Arginine,L-leucyl-L-tryptophyl-L-methionyl |
| H-Leu-Trp-Met-Arg-OH |