bis[(4-nitrophenyl)methyl] propanedioate structure
|
Common Name | bis[(4-nitrophenyl)methyl] propanedioate | ||
|---|---|---|---|---|
| CAS Number | 67245-85-6 | Molecular Weight | 374.30200 | |
| Density | 1.422g/cm3 | Boiling Point | 544.2ºC at 760 mmHg | |
| Molecular Formula | C17H14N2O8 | Melting Point | 89ºC | |
| MSDS | N/A | Flash Point | 227.9ºC | |
| Name | Bis(4-nitrobenzyl) Malonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.422g/cm3 |
|---|---|
| Boiling Point | 544.2ºC at 760 mmHg |
| Melting Point | 89ºC |
| Molecular Formula | C17H14N2O8 |
| Molecular Weight | 374.30200 |
| Flash Point | 227.9ºC |
| Exact Mass | 374.07500 |
| PSA | 144.24000 |
| LogP | 3.72610 |
| Index of Refraction | 1.606 |
| InChIKey | RBVOYZBIDZCDBO-UHFFFAOYSA-N |
| SMILES | O=C(CC(=O)OCc1ccc([N+](=O)[O-])cc1)OCc1ccc([N+](=O)[O-])cc1 |
|
~50%
bis[(4-nitrophe... CAS#:67245-85-6 |
| Literature: Schmitt, Susan M.; Johnston, David B.R.; Christensen, B.G. Journal of Organic Chemistry, 1980 , vol. 45, # 6 p. 1142 - 1148 |
| bis[(4-nitrophenyl)methyl] propanedioate |