1-[bromo-bis(4-nitrophenyl)methyl]-4-nitrobenzene
Modify Date: 2025-08-25 07:25:36
![1-[bromo-bis(4-nitrophenyl)methyl]-4-nitrobenzene Structure](https://image.chemsrc.com/caspic/156/38389-64-9.png)
1-[bromo-bis(4-nitrophenyl)methyl]-4-nitrobenzene structure
|
Common Name | 1-[bromo-bis(4-nitrophenyl)methyl]-4-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 38389-64-9 | Molecular Weight | 458.21900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H12BrN3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-[bromo-bis(4-nitrophenyl)methyl]-4-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H12BrN3O6 |
|---|---|
| Molecular Weight | 458.21900 |
| Exact Mass | 456.99100 |
| PSA | 137.46000 |
| LogP | 6.66760 |
| InChIKey | RIPAOAYGWVXNCS-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(C(Br)(c2ccc([N+](=O)[O-])cc2)c2ccc([N+](=O)[O-])cc2)cc1 |
|
~%
1-[bromo-bis(4-... CAS#:38389-64-9 |
| Literature: Lewis; Lipkin; Magel Journal of the American Chemical Society, 1944 , vol. 66, p. 1579,1583 |
|
~%
1-[bromo-bis(4-... CAS#:38389-64-9 |
| Literature: Ziegler; Boye Justus Liebigs Annalen der Chemie, 1927 , vol. 458, p. 254,255 |
![1-[bis(4-nitrophenyl)methyl]-4-nitro-benzene structure](https://image.chemsrc.com/caspic/310/603-49-6.png)
CAS#:596-48-5| Tri(p-nitrophenyl)methylbromid |
| Brom-tris-<4-nitro-phenyl>-methan |
| Tris-(4-nitrophenyl)-methylbromid |
| tris(p-nitrophenyl)methyl bromide |
| 4,4',4''-trinitro-trityl bromide |
| 4,4',4''-Trinitro-tritylbromid |
| Benzene,1,1',1''-(bromomethylidyne)tris[4-nitro |