2-(diethylamino)-3,5,6-trifluorobenzene-1,4-dicarbonitrile
Modify Date: 2025-08-25 11:02:00
2-(diethylamino)-3,5,6-trifluorobenzene-1,4-dicarbonitrile structure
|
Common Name | 2-(diethylamino)-3,5,6-trifluorobenzene-1,4-dicarbonitrile | ||
|---|---|---|---|---|
| CAS Number | 67205-69-0 | Molecular Weight | 253.22300 | |
| Density | 1.29g/cm3 | Boiling Point | 358.2ºC at 760 mmHg | |
| Molecular Formula | C12H10F3N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 170.4ºC | |
| Name | 2-(diethylamino)-3,5,6-trifluorobenzene-1,4-dicarbonitrile |
|---|
| Density | 1.29g/cm3 |
|---|---|
| Boiling Point | 358.2ºC at 760 mmHg |
| Molecular Formula | C12H10F3N3 |
| Molecular Weight | 253.22300 |
| Flash Point | 170.4ºC |
| Exact Mass | 253.08300 |
| PSA | 50.82000 |
| LogP | 2.69346 |
| Index of Refraction | 1.51 |
| InChIKey | BDQIFSKVJYMSJT-UHFFFAOYSA-N |
| SMILES | CCN(CC)c1c(F)c(C#N)c(F)c(F)c1C#N |
|
~%
2-(diethylamino... CAS#:67205-69-0 |
| Literature: Heilman; Battershell; Pyne; Goble; Magee Journal of Medicinal Chemistry, 1978 , vol. 21, # 9 p. 906 - 913 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |