dibutyl (Z)-2-iodobut-2-enedioate structure
|
Common Name | dibutyl (Z)-2-iodobut-2-enedioate | ||
|---|---|---|---|---|
| CAS Number | 67191-75-7 | Molecular Weight | 354.18100 | |
| Density | 1.44g/cm3 | Boiling Point | 359.7ºC at 760 mmHg | |
| Molecular Formula | C12H19IO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 171.3ºC | |
| Name | dibutyl (Z)-2-iodobut-2-enedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.44g/cm3 |
|---|---|
| Boiling Point | 359.7ºC at 760 mmHg |
| Molecular Formula | C12H19IO4 |
| Molecular Weight | 354.18100 |
| Flash Point | 171.3ºC |
| Exact Mass | 354.03300 |
| PSA | 52.60000 |
| LogP | 2.99190 |
| Index of Refraction | 1.514 |
| InChIKey | KMICEZNUDDYZII-KTKRTIGZSA-N |
| SMILES | CCCCOC(=O)C=C(I)C(=O)OCCCC |
|
~%
dibutyl (Z)-2-i... CAS#:67191-75-7 |
| Literature: Gershon; Shanks Journal of Pharmaceutical Sciences, 1978 , vol. 67, # 4 p. 578 - 580 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| n-Butyl-jodfumarat |