2-Butenedioic acid,2-chloro-, dibutyl ester, (Z)- (9CI)
Modify Date: 2025-09-26 18:45:43
2-Butenedioic acid,2-chloro-, dibutyl ester, (Z)- (9CI) structure
|
Common Name | 2-Butenedioic acid,2-chloro-, dibutyl ester, (Z)- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 22801-48-5 | Molecular Weight | 262.73000 | |
| Density | 1.102g/cm3 | Boiling Point | 324.5ºC at 760mmHg | |
| Molecular Formula | C12H19ClO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 117.6ºC | |
| Name | dibutyl (Z)-2-chlorobut-2-enedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.102g/cm3 |
|---|---|
| Boiling Point | 324.5ºC at 760mmHg |
| Molecular Formula | C12H19ClO4 |
| Molecular Weight | 262.73000 |
| Flash Point | 117.6ºC |
| Exact Mass | 262.09700 |
| PSA | 52.60000 |
| LogP | 2.79570 |
| Vapour Pressure | 0.000244mmHg at 25°C |
| Index of Refraction | 1.465 |
| InChIKey | OOTSYUCEDPKLGT-KTKRTIGZSA-N |
| SMILES | CCCCOC(=O)C=C(Cl)C(=O)OCCCC |
|
~%
2-Butenedioic a... CAS#:22801-48-5 |
| Literature: Satta et al. Journal of the American Chemical Society, 1953 , vol. 75, p. 4101 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Chlormaleinsaeure-dibutylester |
| chloromaleic acid dibutyl ester |