1r)-(+)-camphanic acid structure
|
Common Name | 1r)-(+)-camphanic acid | ||
|---|---|---|---|---|
| CAS Number | 67111-66-4 | Molecular Weight | 198.21600 | |
| Density | 1.296 g/cm3 | Boiling Point | 355.5ºC at 760 mmHg | |
| Molecular Formula | C10H14O4 | Melting Point | 200-202ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 142.1ºC | |
| Name | (1R)-(+)-Camphanic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.296 g/cm3 |
|---|---|
| Boiling Point | 355.5ºC at 760 mmHg |
| Melting Point | 200-202ºC(lit.) |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.21600 |
| Flash Point | 142.1ºC |
| Exact Mass | 198.08900 |
| PSA | 63.60000 |
| LogP | 1.19290 |
| Index of Refraction | 1.532 |
| InChIKey | KPWKPGFLZGMMFX-ZJUUUORDSA-N |
| SMILES | CC12CCC(C(=O)O)(OC1=O)C2(C)C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xn |
| Risk Phrases | R20/21/22 |
| Safety Phrases | 22-24/25-36-26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2932209090 |
| HS Code | 2932209090 |
|---|---|
| Summary | 2932209090. other lactones. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Tetrahedron Lett. 32 , 3169, (1991)
|
| MFCD00005535 |