4-Amino-6-chlorobenzene-1,3-di(sulphonyl chloride) structure
|
Common Name | 4-Amino-6-chlorobenzene-1,3-di(sulphonyl chloride) | ||
|---|---|---|---|---|
| CAS Number | 671-89-6 | Molecular Weight | 324.58900 | |
| Density | 1.834 g/cm3 | Boiling Point | 474.2ºC at 760 mmHg | |
| Molecular Formula | C6H4Cl3NO4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 240.6ºC | |
| Name | 4-Amino-6-chlorobenzene-1,3-disulfonyl dichloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.834 g/cm3 |
|---|---|
| Boiling Point | 474.2ºC at 760 mmHg |
| Molecular Formula | C6H4Cl3NO4S2 |
| Molecular Weight | 324.58900 |
| Flash Point | 240.6ºC |
| Exact Mass | 322.86500 |
| PSA | 111.06000 |
| LogP | 4.52000 |
| Index of Refraction | 1.624 |
| InChIKey | YIZXGHNDQUYDDF-UHFFFAOYSA-N |
| SMILES | Nc1cc(Cl)c(S(=O)(=O)Cl)cc1S(=O)(=O)Cl |
| HS Code | 2921499090 |
|---|
|
~15%
4-Amino-6-chlor... CAS#:671-89-6 |
| Literature: Thevis, Mario; Schmickler, M Hans; Schaenzert, Wilhelm Analytical chemistry, 2002 , vol. 74, # 15 p. 3802 - 3808 |
| HS Code | 2921499090 |
|---|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4-amino-6-chlorobenzene-1,3-disulfonyl chloride |