4-amino-6-(1,2,2-trichloroethenyl)benzene-1,3-disulfonyl chloride
Modify Date: 2025-09-03 11:18:34
4-amino-6-(1,2,2-trichloroethenyl)benzene-1,3-disulfonyl chloride structure
|
Common Name | 4-amino-6-(1,2,2-trichloroethenyl)benzene-1,3-disulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 60285-85-0 | Molecular Weight | 419.51700 | |
| Density | 1.849g/cm3 | Boiling Point | 545.7ºC at 760 mmHg | |
| Molecular Formula | C8H4Cl5NO4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 283.8ºC | |
| Name | 4-amino-6-(1,2,2-trichloroethenyl)benzene-1,3-disulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.849g/cm3 |
|---|---|
| Boiling Point | 545.7ºC at 760 mmHg |
| Molecular Formula | C8H4Cl5NO4S2 |
| Molecular Weight | 419.51700 |
| Flash Point | 283.8ºC |
| Exact Mass | 416.80200 |
| PSA | 111.06000 |
| LogP | 6.20910 |
| Index of Refraction | 1.631 |
| InChIKey | YQBCCKGOIWMSDK-UHFFFAOYSA-N |
| SMILES | Nc1cc(C(Cl)=C(Cl)Cl)c(S(=O)(=O)Cl)cc1S(=O)(=O)Cl |
| HS Code | 2921499090 |
|---|
| HS Code | 2921499090 |
|---|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| EINECS 262-146-3 |
| 4-Amino-6-(trichlorovinyl)benzene-1,3-disulphonyl dichloride |
| 4-amino-6-(trichlorovinyl)benzene-1,3-disulfonyl dichloride |
| 4-Amino-6-(trichlorethenyl)-1,3-benzoldisulfonylchlorid |