4-(3-Bromophenyl)-6-phenyl-2-pyrimidinamine structure
|
Common Name | 4-(3-Bromophenyl)-6-phenyl-2-pyrimidinamine | ||
|---|---|---|---|---|
| CAS Number | 67005-21-4 | Molecular Weight | 326.191 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 525.9±42.0 °C at 760 mmHg | |
| Molecular Formula | C16H12BrN3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 271.9±27.9 °C | |
| Name | 4-(3-bromophenyl)-6-phenylpyrimidin-2-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 525.9±42.0 °C at 760 mmHg |
| Molecular Formula | C16H12BrN3 |
| Molecular Weight | 326.191 |
| Flash Point | 271.9±27.9 °C |
| Exact Mass | 325.021454 |
| PSA | 52.53000 |
| LogP | 4.56 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.665 |
| InChIKey | SMZYUUMTUYREMF-UHFFFAOYSA-N |
| SMILES | Nc1nc(-c2ccccc2)cc(-c2cccc(Br)c2)n1 |
| HS Code | 2933599090 |
|---|
|
~63%
4-(3-Bromopheny... CAS#:67005-21-4 |
| Literature: Goswami, Shyamaprosad; Jana, Subrata; Dey, Swapan; Kumar Adak, Avijit Australian Journal of Chemistry, 2007 , vol. 60, # 2 p. 120 - 123 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Pyrimidinamine, 4-(3-bromophenyl)-6-phenyl- |
| 4-(3-bromo-phenyl)-6-phenyl-pyrimidin-2-ylamine |
| 4-(3-Bromophenyl)-6-phenyl-2-pyrimidinamine |
| 2-amino-6-(m-bromophenyl)-4-phenylpyrimidine |