ART-CHEM-BB B018189
Modify Date: 2025-10-15 18:56:27
ART-CHEM-BB B018189 structure
|
Common Name | ART-CHEM-BB B018189 | ||
|---|---|---|---|---|
| CAS Number | 669748-48-5 | Molecular Weight | 288.41100 | |
| Density | 1.13g/cm3 | Boiling Point | 394.4ºC at 760 mmHg | |
| Molecular Formula | C15H20N4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 192.3ºC | |
| Name | 3-[4-(diethylamino)phenyl]-4-prop-2-enyl-1H-1,2,4-triazole-5-thione |
|---|
| Density | 1.13g/cm3 |
|---|---|
| Boiling Point | 394.4ºC at 760 mmHg |
| Molecular Formula | C15H20N4S |
| Molecular Weight | 288.41100 |
| Flash Point | 192.3ºC |
| Exact Mass | 288.14100 |
| PSA | 72.75000 |
| LogP | 3.26600 |
| Index of Refraction | 1.603 |
| InChIKey | RAGPQLCQEQJMOG-UHFFFAOYSA-N |
| SMILES | C=CCn1c(-c2ccc(N(CC)CC)cc2)n[nH]c1=S |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |