ART-CHEM-BB B018087
Modify Date: 2025-08-26 10:56:27
ART-CHEM-BB B018087 structure
|
Common Name | ART-CHEM-BB B018087 | ||
|---|---|---|---|---|
| CAS Number | 669705-44-6 | Molecular Weight | 263.35900 | |
| Density | 1.2g/cm3 | Boiling Point | 374.1ºC at 760 mmHg | |
| Molecular Formula | C13H17N3OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 180ºC | |
| Name | 3-[(2,3-dimethylphenoxy)methyl]-4-ethyl-1H-1,2,4-triazole-5-thione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2g/cm3 |
|---|---|
| Boiling Point | 374.1ºC at 760 mmHg |
| Molecular Formula | C13H17N3OS |
| Molecular Weight | 263.35900 |
| Flash Point | 180ºC |
| Exact Mass | 263.10900 |
| PSA | 78.74000 |
| LogP | 2.78250 |
| Index of Refraction | 1.611 |
| InChIKey | VETCDUKXEFDLTR-UHFFFAOYSA-N |
| SMILES | CCn1c(COc2cccc(C)c2C)n[nH]c1=S |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-[(2,3-dimethylphenoxy)methyl]-4-ethyl-4H-1,2,4-triazole-3-thiol |