6'-fluoro-2',3'-dihydro-2H,5H-spiro[imidazolidine-4,4'-thiochromene]-2,5-dione 1',1'-dioxide structure
|
Common Name | 6'-fluoro-2',3'-dihydro-2H,5H-spiro[imidazolidine-4,4'-thiochromene]-2,5-dione 1',1'-dioxide | ||
|---|---|---|---|---|
| CAS Number | 66892-63-5 | Molecular Weight | 284.26400 | |
| Density | 1.68g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H9FN2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-fluoro-1,1-dioxospiro[2,3-dihydrothiochromene-4,5'-imidazolidine]-2',4'-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.68g/cm3 |
|---|---|
| Molecular Formula | C11H9FN2O4S |
| Molecular Weight | 284.26400 |
| Exact Mass | 284.02700 |
| PSA | 100.72000 |
| LogP | 1.77620 |
| Index of Refraction | 1.661 |
| InChIKey | YTHRHFDCECODBU-UHFFFAOYSA-N |
| SMILES | O=C1NC(=O)C2(CCS(=O)(=O)c3ccc(F)cc32)N1 |
| HS Code | 2934999090 |
|---|
|
~%
6'-fluoro-2',3'... CAS#:66892-63-5 |
| Literature: Sarges; Schnur; Belletire; Peterson Journal of Medicinal Chemistry, 1988 , vol. 31, # 1 p. 230 - 243 |
|
~73%
6'-fluoro-2',3'... CAS#:66892-63-5 |
| Literature: Sarges; Schnur; Belletire; Peterson Journal of Medicinal Chemistry, 1988 , vol. 31, # 1 p. 230 - 243 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD05267731 |