trimethyl-[2,4,6-trichloro-3,5-bis(trimethylsilyl)-1,3,5,2,4,6-triazatriborinan-1-yl]silane
Modify Date: 2025-09-01 19:17:42
![trimethyl-[2,4,6-trichloro-3,5-bis(trimethylsilyl)-1,3,5,2,4,6-triazatriborinan-1-yl]silane Structure](https://image.chemsrc.com/caspic/357/6689-32-3.png)
trimethyl-[2,4,6-trichloro-3,5-bis(trimethylsilyl)-1,3,5,2,4,6-triazatriborinan-1-yl]silane structure
|
Common Name | trimethyl-[2,4,6-trichloro-3,5-bis(trimethylsilyl)-1,3,5,2,4,6-triazatriborinan-1-yl]silane | ||
|---|---|---|---|---|
| CAS Number | 6689-32-3 | Molecular Weight | 400.37900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H27B3Cl3N3Si3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | trimethyl-[2,4,6-trichloro-3,5-bis(trimethylsilyl)-1,3,5,2,4,6-triazatriborinan-1-yl]silane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H27B3Cl3N3Si3 |
|---|---|
| Molecular Weight | 400.37900 |
| Exact Mass | 399.08600 |
| PSA | 9.72000 |
| LogP | 3.89550 |
| InChIKey | QGVYHGIUZSKNQX-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)N1B(Cl)N([Si](C)(C)C)B(Cl)N([Si](C)(C)C)B1Cl |
|
~62%
trimethyl-[2,4,... CAS#:6689-32-3 |
| Literature: Anand, Benadir; Noeth, Heinrich; Schwenk-Kircher, Holger; Troll, Alexander European Journal of Inorganic Chemistry, 2008 , # 20 p. 3186 - 3199 |
|
~65%
trimethyl-[2,4,... CAS#:6689-32-3 |
| Literature: Anand, Benadir; Noeth, Heinrich; Schwenk-Kircher, Holger; Troll, Alexander European Journal of Inorganic Chemistry, 2008 , # 20 p. 3186 - 3199 |
|
~76%
trimethyl-[2,4,... CAS#:6689-32-3 |
| Literature: Gasparis-Ebeling, Theo; Noeth, Heinrich Chemische Berichte, 1990 , vol. 123, p. 261 - 270 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2,4,6-trichloro-1,3,5-tris-trimethylsilanyl-cyclotriborazane |
| N-trimethylsilyl-B-trichloroborazine |
| B-Trichlor-N-tris-trimethylsilyl-borazol |
| 1,3,5-Tris-trimethylsilyl-2,4,6-trichlor-borazol |