(1-TERT-BUTYL-BUT-3-ENYLOXYMETHYL)-BENZENE
Modify Date: 2025-12-08 21:32:52
(1-TERT-BUTYL-BUT-3-ENYLOXYMETHYL)-BENZENE structure
|
Common Name | (1-TERT-BUTYL-BUT-3-ENYLOXYMETHYL)-BENZENE | ||
|---|---|---|---|---|
| CAS Number | 66824-86-0 | Molecular Weight | 226.27400 | |
| Density | 1.13g/cm3 | Boiling Point | 427.6ºC at 760 mmHg | |
| Molecular Formula | C14H14N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 212.4ºC | |
| Name | N'-Hydroxy-2,2-diphenylethanimidamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.13g/cm3 |
|---|---|
| Boiling Point | 427.6ºC at 760 mmHg |
| Molecular Formula | C14H14N2O |
| Molecular Weight | 226.27400 |
| Flash Point | 212.4ºC |
| Exact Mass | 226.11100 |
| PSA | 56.11000 |
| LogP | 3.26520 |
| Index of Refraction | 1.594 |
| InChIKey | KTMXYVWQDZLZAI-UHFFFAOYSA-N |
| SMILES | NC(=NO)C(c1ccccc1)c1ccccc1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2925290090 |
|
~86%
(1-TERT-BUTYL-B... CAS#:66824-86-0 |
| Literature: Ekcstein, Zygmunt; Rusek, Dorota; Bany, Robert; Jelenski, Pawel Polish Journal of Chemistry, 1981 , vol. 55, # 6 p. 1253 - 1264 |
|
~%
(1-TERT-BUTYL-B... CAS#:66824-86-0 |
| Literature: Lipp Justus Liebigs Annalen der Chemie, 1926 , vol. 449, p. 21 |
|
~%
(1-TERT-BUTYL-B... CAS#:66824-86-0 |
| Literature: Lipp Justus Liebigs Annalen der Chemie, 1926 , vol. 449, p. 21 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 2,2-diphenyl-acetamide oxime |
| 2,2-Diphenyl-acetamidoxim |
| HMS2577D05 |