AKOS B013835
Modify Date: 2024-02-04 16:01:35
AKOS B013835 structure
|
Common Name | AKOS B013835 | ||
|---|---|---|---|---|
| CAS Number | 667412-76-2 | Molecular Weight | 225.19800 | |
| Density | 1.328g/cm3 | Boiling Point | 403.9ºC at 760 mmHg | |
| Molecular Formula | C10H11NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198.1ºC | |
| Name | 2-(3-methyl-4-nitrophenoxy)propanoic acid |
|---|
| Density | 1.328g/cm3 |
|---|---|
| Boiling Point | 403.9ºC at 760 mmHg |
| Molecular Formula | C10H11NO5 |
| Molecular Weight | 225.19800 |
| Flash Point | 198.1ºC |
| Exact Mass | 225.06400 |
| PSA | 92.35000 |
| LogP | 2.27830 |
| Index of Refraction | 1.563 |
| InChIKey | WOWVFMALMORJJS-UHFFFAOYSA-N |
| SMILES | Cc1cc(OC(C)C(=O)O)ccc1[N+](=O)[O-] |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2918990090 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |