Ethyl bromo(nitro)acetate
Modify Date: 2024-02-02 17:15:11
Ethyl bromo(nitro)acetate structure
|
Common Name | Ethyl bromo(nitro)acetate | ||
|---|---|---|---|---|
| CAS Number | 6653-28-7 | Molecular Weight | 211.99900 | |
| Density | 1.704g/cm3 | Boiling Point | 207.1ºC at 760 mmHg | |
| Molecular Formula | C4H6BrNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 79ºC | |
| Name | Ethyl bromo(nitro)acetate |
|---|
| Density | 1.704g/cm3 |
|---|---|
| Boiling Point | 207.1ºC at 760 mmHg |
| Molecular Formula | C4H6BrNO4 |
| Molecular Weight | 211.99900 |
| Flash Point | 79ºC |
| Exact Mass | 210.94800 |
| PSA | 72.12000 |
| LogP | 1.07040 |
| Index of Refraction | 1.491 |
| InChIKey | LWSZLBNYFWTRQY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(Br)[N+](=O)[O-] |
| HS Code | 2915900090 |
|---|
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |