1-Pentanol, 2-methyl-, 3,5-dinitrobenzoate
Modify Date: 2025-08-20 19:10:49
1-Pentanol, 2-methyl-, 3,5-dinitrobenzoate structure
|
Common Name | 1-Pentanol, 2-methyl-, 3,5-dinitrobenzoate | ||
|---|---|---|---|---|
| CAS Number | 66516-52-7 | Molecular Weight | 296.27600 | |
| Density | 1.266g/cm3 | Boiling Point | 407.8ºC at 760 mmHg | |
| Molecular Formula | C13H16N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 165.9ºC | |
| Name | 2-methylpentyl 3,5-dinitrobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.266g/cm3 |
|---|---|
| Boiling Point | 407.8ºC at 760 mmHg |
| Molecular Formula | C13H16N2O6 |
| Molecular Weight | 296.27600 |
| Flash Point | 165.9ºC |
| Exact Mass | 296.10100 |
| PSA | 117.94000 |
| LogP | 4.14240 |
| Index of Refraction | 1.547 |
| InChIKey | MYVAWRQTVWUGOR-UHFFFAOYSA-N |
| SMILES | CCCC(C)COC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
|
~95%
1-Pentanol, 2-m... CAS#:66516-52-7 |
| Literature: Sakata; Okabe; Kuwahara Bioscience, biotechnology, and biochemistry, 2001 , vol. 65, # 4 p. 919 - 927 |
|
~%
1-Pentanol, 2-m... CAS#:66516-52-7 |
| Literature: Sutter Helvetica Chimica Acta, 1938 , vol. 21, p. 1269 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 3,5-Dinitro-benzoesaeure-(2-methyl-pentylester) |
| 2-Methyl-pentanol-3,5-dinitrobenzoat |
| 1-Pentanol,3,5-dinitrobenzoate |
| 3,5-dinitro-benzoic acid-(2-methyl-pentyl ester) |
| 2-Methylpentanol 3,5-dinitrobenzoate |