1-[3-(4-chlorophenyl)-5-methyl-1,2,4-triazol-1-yl]ethanone structure
|
Common Name | 1-[3-(4-chlorophenyl)-5-methyl-1,2,4-triazol-1-yl]ethanone | ||
|---|---|---|---|---|
| CAS Number | 66492-64-6 | Molecular Weight | 235.67000 | |
| Density | 1.32g/cm3 | Boiling Point | 411.8ºC at 760 mmHg | |
| Molecular Formula | C11H10ClN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 202.9ºC | |
| Name | 1-[3-(4-chlorophenyl)-5-methyl-1,2,4-triazol-1-yl]ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.32g/cm3 |
|---|---|
| Boiling Point | 411.8ºC at 760 mmHg |
| Molecular Formula | C11H10ClN3O |
| Molecular Weight | 235.67000 |
| Flash Point | 202.9ºC |
| Exact Mass | 235.05100 |
| PSA | 47.78000 |
| LogP | 2.56700 |
| Index of Refraction | 1.63 |
| InChIKey | PJZJQGCCUDQKRG-UHFFFAOYSA-N |
| SMILES | CC(=O)n1nc(-c2ccc(Cl)cc2)nc1C |
|
~64%
1-[3-(4-chlorop... CAS#:66492-64-6 |
| Literature: Wade; Vogt; Kissick; Simpkins; Palmer; Millonig Journal of Medicinal Chemistry, 1982 , vol. 25, # 3 p. 331 - 333 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1-acetyl-3-<4-chloro-phenyl>-5-methyl-1H-1.2.4-triazole |
| 1H-1,2,4-Triazole,1-acetyl-3-(p-chlorophenyl)-5-methyl |
| 1-Acetyl-3-(p-chlorophenyl)-5-methyl-1,2,4-triazole |