N,N-dimethylspiro[3.3]heptane-2,6-dicarboxamide structure
|
Common Name | N,N-dimethylspiro[3.3]heptane-2,6-dicarboxamide | ||
|---|---|---|---|---|
| CAS Number | 6641-48-1 | Molecular Weight | 210.27300 | |
| Density | 1.14g/cm3 | Boiling Point | 498.7ºC at 760 mmHg | |
| Molecular Formula | C11H18N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 218.2ºC | |
| Name | N,N'-dimethylspiro[3.3]heptane-2,6-dicarboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.14g/cm3 |
|---|---|
| Boiling Point | 498.7ºC at 760 mmHg |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.27300 |
| Flash Point | 218.2ºC |
| Exact Mass | 210.13700 |
| PSA | 58.20000 |
| LogP | 1.06660 |
| Index of Refraction | 1.524 |
| InChIKey | JDUWPJKFFQCJFM-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1CC2(C1)CC(C(=O)NC)C2 |
|
~%
N,N-dimethylspi... CAS#:6641-48-1 |
| Literature: Rice,L.M.; Grogan,C.H. Journal of Organic Chemistry, 1961 , vol. 26, p. 54 - 58 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2,5-Bis-(n-butylamino)-p-benzochinon |
| 2,5-Bis-(butylamino)-benzochinon-(1,4) |
| 2,5-bis(n-butylamino)-1,4-benzoquinone |
| 2,5-Bis-(N-methylamido)-spiro<3.3>heptan |
| 2,5-Bis-butylamino-[1,4]benzochinon |
| 2,5-bis(n-butylamino)-p-benzoquinone |
| 2,5-bis-butylamino-[1,4]benzoquinone |