Fecht acid
Modify Date: 2025-08-23 20:31:46
Fecht acid structure
|
Common Name | Fecht acid | ||
|---|---|---|---|---|
| CAS Number | 3057-91-8 | Molecular Weight | 184.18900 | |
| Density | 1.4g/cm3 | Boiling Point | 417.8ºC at 760mmHg | |
| Molecular Formula | C9H12O4 | Melting Point | 230-235℃ | |
| MSDS | N/A | Flash Point | 220.6ºC | |
| Name | spiro[3.3]heptane-2,6-dicarboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4g/cm3 |
|---|---|
| Boiling Point | 417.8ºC at 760mmHg |
| Melting Point | 230-235℃ |
| Molecular Formula | C9H12O4 |
| Molecular Weight | 184.18900 |
| Flash Point | 220.6ºC |
| Exact Mass | 184.07400 |
| PSA | 74.60000 |
| LogP | 0.96200 |
| Index of Refraction | 1.568 |
| InChIKey | JQZAKMJZYGPUFD-UHFFFAOYSA-N |
| SMILES | O=C(O)C1CC2(C1)CC(C(=O)O)C2 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2917209090 |
| HS Code | 2917209090 |
|---|---|
| Summary | 2917209090 other cyclanic, cyclenic or cyclotherpenic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| Fecht's acid |
| symm. Spiroheptan-dicarbonsaeure |
| Fecht acid |