Acetamide,N-[1-[2-(acetyloxy)-1-naphthalenyl]ethyl]- structure
|
Common Name | Acetamide,N-[1-[2-(acetyloxy)-1-naphthalenyl]ethyl]- | ||
|---|---|---|---|---|
| CAS Number | 6640-35-3 | Molecular Weight | 271.31100 | |
| Density | 1.16g/cm3 | Boiling Point | 478.7ºC at 760 mmHg | |
| Molecular Formula | C16H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 243.3ºC | |
| Name | [1-(1-acetamidoethyl)naphthalen-2-yl] acetate |
|---|
| Density | 1.16g/cm3 |
|---|---|
| Boiling Point | 478.7ºC at 760 mmHg |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.31100 |
| Flash Point | 243.3ºC |
| Exact Mass | 271.12100 |
| PSA | 55.40000 |
| LogP | 3.35310 |
| Index of Refraction | 1.58 |
| InChIKey | SKLCITCRNZBTNH-UHFFFAOYSA-N |
| SMILES | CC(=O)NC(C)c1c(OC(C)=O)ccc2ccccc12 |
|
~%
Acetamide,N-[1-... CAS#:6640-35-3 |
| Literature: Burke; Reynolds Journal of the American Chemical Society, 1954 , vol. 76, p. 1291 |
|
~%
Acetamide,N-[1-... CAS#:6640-35-3 |
| Literature: Burke; Reynolds Journal of the American Chemical Society, 1954 , vol. 76, p. 1291 |
|
~%
Acetamide,N-[1-... CAS#:6640-35-3 |
| Literature: Burke; Reynolds Journal of the American Chemical Society, 1954 , vol. 76, p. 1291 |